C12H13ClN2OS — CID 112554405
2-chloro-6-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]phenol (PubChem CID 112554405) has the molecular formula C12H13ClN2OS and a molecular weight of 268.77 g/mol. Its IUPAC name is 2-chloro-6-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]phenol.
| Compound Name | 2-chloro-6-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 112554405 |
| Molecular Formula | C12H13ClN2OS |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 2-chloro-6-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]phenol |
| SMILES | Oc1c(Cl)cccc1CNCCc1nccs1 |
| InChI | InChI=1S/C12H13ClN2OS/c13-10-3-1-2-9(12(10)16)8-14-5-4-11-15-6-7-17-11/h1-3,6-7,14,16H,4-5,8H2 |
| InChIKey | YTASLNMNTAWPSO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|