C11H13ClN4O — CID 112568744
2-chloro-6-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]phenol (PubChem CID 112568744) has the molecular formula C11H13ClN4O and a molecular weight of 252.71 g/mol. Its IUPAC name is 2-chloro-6-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]phenol.
| Compound Name | 2-chloro-6-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 112568744 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.71 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-chloro-6-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]phenol |
| SMILES | Oc1c(Cl)cccc1CNCCc1ncn[nH]1 |
| InChI | InChI=1S/C11H13ClN4O/c12-9-3-1-2-8(11(9)17)6-13-5-4-10-14-7-15-16-10/h1-3,7,13,17H,4-6H2,(H,14,15,16) |
| InChIKey | KUIVTNQAZIVCRZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.71 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|