C11H15N5 — CID 66417495
2-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]aniline (PubChem CID 66417495) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 2-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]aniline.
| Compound Name | 2-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]aniline |
|---|---|
| PubChem CID | 66417495 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]aniline |
| SMILES | Nc1ccccc1CNCCc1ncn[nH]1 |
| InChI | InChI=1S/C11H15N5/c12-10-4-2-1-3-9(10)7-13-6-5-11-14-8-15-16-11/h1-4,8,13H,5-7,12H2,(H,14,15,16) |
| InChIKey | NONBDIMJSLKICY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|