C11H14N4O — CID 64545789
3-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]phenol (PubChem CID 64545789) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]phenol.
| Compound Name | 3-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 64545789 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]phenol |
| SMILES | Oc1cccc(CNCCc2ncn[nH]2)c1 |
| InChI | InChI=1S/C11H14N4O/c16-10-3-1-2-9(6-10)7-12-5-4-11-13-8-14-15-11/h1-3,6,8,12,16H,4-5,7H2,(H,13,14,15) |
| InChIKey | UZCYRQQKVHDYOK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|