C13H18N4 — CID 64548497
3-phenyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]propan-1-amine (PubChem CID 64548497) has the molecular formula C13H18N4 and a molecular weight of 230.32 g/mol. Its IUPAC name is 3-phenyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]propan-1-amine.
| Compound Name | 3-phenyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 64548497 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.32 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 3-phenyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]propan-1-amine |
| SMILES | c1ccc(CCCNCCc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C13H18N4/c1-2-5-12(6-3-1)7-4-9-14-10-8-13-15-11-16-17-13/h1-3,5-6,11,14H,4,7-10H2,(H,15,16,17) |
| InChIKey | IMOIVHHOSZPENQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|