C12H16N4O2S — CID 64532096
2-phenyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]ethanesulfonamide (PubChem CID 64532096) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-phenyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]ethanesulfonamide.
| Compound Name | 2-phenyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 64532096 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-phenyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]ethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccccc1)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C12H16N4O2S/c17-19(18,9-7-11-4-2-1-3-5-11)15-8-6-12-13-10-14-16-12/h1-5,10,15H,6-9H2,(H,13,14,16) |
| InChIKey | DUZXYUANHBYIRM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |