C7H14N4O3S — CID 79579379
2-hydroxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]ethanesulfonamide (PubChem CID 79579379) has the molecular formula C7H14N4O3S and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-hydroxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]ethanesulfonamide.
| Compound Name | 2-hydroxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]ethanesulfonamide |
|---|---|
| PubChem CID | 79579379 |
| Molecular Formula | C7H14N4O3S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-hydroxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]ethanesulfonamide |
| SMILES | O=S(=O)(CCO)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C7H14N4O3S/c12-4-5-15(13,14)10-3-1-2-7-8-6-9-11-7/h6,10,12H,1-5H2,(H,8,9,11) |
| InChIKey | WWSMHJKSNUGORN-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|