C10H13N5O2S — CID 64518969
4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 64518969) has the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. Its IUPAC name is 4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 64518969 |
| Molecular Formula | C10H13N5O2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 4-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NCCc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C10H13N5O2S/c11-8-1-3-9(4-2-8)18(16,17)14-6-5-10-12-7-13-15-10/h1-4,7,14H,5-6,11H2,(H,12,13,15) |
| InChIKey | BUTOOVJVKFNZKT-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|