C10H12FN5O2S — CID 64518578
2-amino-4-fluoro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 64518578) has the molecular formula C10H12FN5O2S and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-amino-4-fluoro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-amino-4-fluoro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 64518578 |
| Molecular Formula | C10H12FN5O2S |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-amino-4-fluoro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | Nc1cc(F)ccc1S(=O)(=O)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C10H12FN5O2S/c11-7-1-2-9(8(12)5-7)19(17,18)15-4-3-10-13-6-14-16-10/h1-2,5-6,15H,3-4,12H2,(H,13,14,16) |
| InChIKey | SZSGPWHTUTYLRG-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|