C10H12N6O4S — CID 64525550
2-amino-5-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 64525550) has the molecular formula C10H12N6O4S and a molecular weight of 312.31 g/mol. Its IUPAC name is 2-amino-5-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-amino-5-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 64525550 |
| Molecular Formula | C10H12N6O4S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-amino-5-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | Nc1ccc([N+](=O)[O-])cc1S(=O)(=O)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C10H12N6O4S/c11-8-2-1-7(16(17)18)5-9(8)21(19,20)14-4-3-10-12-6-13-15-10/h1-2,5-6,14H,3-4,11H2,(H,12,13,15) |
| InChIKey | URUOOQYPTKUPJG-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 156.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|