C10H11BrClN5O2S — CID 64519149
3-amino-2-bromo-5-chloro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 64519149) has the molecular formula C10H11BrClN5O2S and a molecular weight of 380.66 g/mol. Its IUPAC name is 3-amino-2-bromo-5-chloro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-amino-2-bromo-5-chloro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 64519149 |
| Molecular Formula | C10H11BrClN5O2S |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | 3-amino-2-bromo-5-chloro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | Nc1cc(Cl)cc(S(=O)(=O)NCCc2ncn[nH]2)c1Br |
| InChI | InChI=1S/C10H11BrClN5O2S/c11-10-7(13)3-6(12)4-8(10)20(18,19)16-2-1-9-14-5-15-17-9/h3-5,16H,1-2,13H2,(H,14,15,17) |
| InChIKey | UQOUXYSFQLGOMN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|