C9H8F2N4O2S — CID 54883734
2,5-difluoro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide (PubChem CID 54883734) has the molecular formula C9H8F2N4O2S and a molecular weight of 274.25 g/mol. Its IUPAC name is 2,5-difluoro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 54883734 |
| Molecular Formula | C9H8F2N4O2S |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 2,5-difluoro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ncn[nH]1)c1cc(F)ccc1F |
| InChI | InChI=1S/C9H8F2N4O2S/c10-6-1-2-7(11)8(3-6)18(16,17)14-4-9-12-5-13-15-9/h1-3,5,14H,4H2,(H,12,13,15) |
| InChIKey | YOYGRRXMLMKRMS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |