C9H10N4O3S — CID 81245663
2-hydroxy-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide (PubChem CID 81245663) has the molecular formula C9H10N4O3S and a molecular weight of 254.27 g/mol. Its IUPAC name is 2-hydroxy-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 2-hydroxy-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 81245663 |
| Molecular Formula | C9H10N4O3S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-hydroxy-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ncn[nH]1)c1ccccc1O |
| InChI | InChI=1S/C9H10N4O3S/c14-7-3-1-2-4-8(7)17(15,16)12-5-9-10-6-11-13-9/h1-4,6,12,14H,5H2,(H,10,11,13) |
| InChIKey | AMHSLFPGBYPOOW-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |