C12H16N4 — CID 64545977
N-[(3-methylphenyl)methyl]-2-(1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 64545977) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is N-[(3-methylphenyl)methyl]-2-(1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | N-[(3-methylphenyl)methyl]-2-(1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 64545977 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | N-[(3-methylphenyl)methyl]-2-(1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | Cc1cccc(CNCCc2ncn[nH]2)c1 |
| InChI | InChI=1S/C12H16N4/c1-10-3-2-4-11(7-10)8-13-6-5-12-14-9-15-16-12/h2-4,7,9,13H,5-6,8H2,1H3,(H,14,15,16) |
| InChIKey | KGKGVGAFSVCMNN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|