C11H12BrFN4 — CID 81002911
N-[(4-bromo-3-fluorophenyl)methyl]-2-(1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 81002911) has the molecular formula C11H12BrFN4 and a molecular weight of 299.15 g/mol. Its IUPAC name is N-[(4-bromo-3-fluorophenyl)methyl]-2-(1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | N-[(4-bromo-3-fluorophenyl)methyl]-2-(1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 81002911 |
| Molecular Formula | C11H12BrFN4 |
| Molecular Weight | 299.15 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | N-[(4-bromo-3-fluorophenyl)methyl]-2-(1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | Fc1cc(CNCCc2ncn[nH]2)ccc1Br |
| InChI | InChI=1S/C11H12BrFN4/c12-9-2-1-8(5-10(9)13)6-14-4-3-11-15-7-16-17-11/h1-2,5,7,14H,3-4,6H2,(H,15,16,17) |
| InChIKey | DNQBYEKCGNSNDU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.15 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|