C13H15N5 — CID 102911084
N-(1H-indol-6-ylmethyl)-2-(1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 102911084) has the molecular formula C13H15N5 and a molecular weight of 241.30 g/mol. Its IUPAC name is N-(1H-indol-6-ylmethyl)-2-(1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | N-(1H-indol-6-ylmethyl)-2-(1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 102911084 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N-(1H-indol-6-ylmethyl)-2-(1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | c1n[nH]c(CCNCc2ccc3cc[nH]c3c2)n1 |
| InChI | InChI=1S/C13H15N5/c1-2-11-3-6-15-12(11)7-10(1)8-14-5-4-13-16-9-17-18-13/h1-3,6-7,9,14-15H,4-5,8H2,(H,16,17,18) |
| InChIKey | ZKIBJPOJEGZYEU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|