C10H13N5 — CID 64546351
N-(pyridin-4-ylmethyl)-2-(1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 64546351) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is N-(pyridin-4-ylmethyl)-2-(1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | N-(pyridin-4-ylmethyl)-2-(1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 64546351 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | N-(pyridin-4-ylmethyl)-2-(1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | c1cc(CNCCc2ncn[nH]2)ccn1 |
| InChI | InChI=1S/C10H13N5/c1-4-11-5-2-9(1)7-12-6-3-10-13-8-14-15-10/h1-2,4-5,8,12H,3,6-7H2,(H,13,14,15) |
| InChIKey | LKENVZSXGYDCCE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|