C12H14N2O2S — CID 63242570
3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]benzene-1,2-diol (PubChem CID 63242570) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]benzene-1,2-diol.
| Compound Name | 3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 63242570 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 3-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]benzene-1,2-diol |
| SMILES | Oc1cccc(CNCCc2nccs2)c1O |
| InChI | InChI=1S/C12H14N2O2S/c15-10-3-1-2-9(12(10)16)8-13-5-4-11-14-6-7-17-11/h1-3,6-7,13,15-16H,4-5,8H2 |
| InChIKey | VHNIYUOPXGCXFC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|