C15H15N3S — CID 63242304
N-(isoquinolin-5-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine (PubChem CID 63242304) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-(isoquinolin-5-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine.
| Compound Name | N-(isoquinolin-5-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 63242304 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N-(isoquinolin-5-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine |
| SMILES | c1cc(CNCCc2nccs2)c2ccncc2c1 |
| InChI | InChI=1S/C15H15N3S/c1-2-12-10-16-6-4-14(12)13(3-1)11-17-7-5-15-18-8-9-19-15/h1-4,6,8-10,17H,5,7,11H2 |
| InChIKey | NCSSSUXXDPKIFX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|