C18H27N3 — CID 62823909
N-(isoquinolin-5-ylmethyl)-N'-methyl-N'-propan-2-ylbutane-1,4-diamine (PubChem CID 62823909) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is N-(isoquinolin-5-ylmethyl)-N'-methyl-N'-propan-2-ylbutane-1,4-diamine.
| Compound Name | N-(isoquinolin-5-ylmethyl)-N'-methyl-N'-propan-2-ylbutane-1,4-diamine |
|---|---|
| PubChem CID | 62823909 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N-(isoquinolin-5-ylmethyl)-N'-methyl-N'-propan-2-ylbutane-1,4-diamine |
| SMILES | CC(C)N(C)CCCCNCc1cccc2cnccc12 |
| InChI | InChI=1S/C18H27N3/c1-15(2)21(3)12-5-4-10-19-13-16-7-6-8-17-14-20-11-9-18(16)17/h6-9,11,14-15,19H,4-5,10,12-13H2,1-3H3 |
| InChIKey | NYQOPAFSEJBIGH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|