C13H22ClN3 — CID 106045751
N-[(3-chloro-4-pyridinyl)methyl]-N'-methyl-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 106045751) has the molecular formula C13H22ClN3 and a molecular weight of 255.79 g/mol. Its IUPAC name is N-[(3-chloro-4-pyridinyl)methyl]-N'-methyl-N'-propan-2-ylpropane-1,3-diamine.
| Compound Name | N-[(3-chloro-4-pyridinyl)methyl]-N'-methyl-N'-propan-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 106045751 |
| Molecular Formula | C13H22ClN3 |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | N-[(3-chloro-4-pyridinyl)methyl]-N'-methyl-N'-propan-2-ylpropane-1,3-diamine |
| SMILES | CC(C)N(C)CCCNCc1ccncc1Cl |
| InChI | InChI=1S/C13H22ClN3/c1-11(2)17(3)8-4-6-15-9-12-5-7-16-10-13(12)14/h5,7,10-11,15H,4,6,8-9H2,1-3H3 |
| InChIKey | LJMKMCBIACQMDJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|