C11H16Cl2N2 — CID 107319957
5-chloro-N-[(3-chloro-4-pyridinyl)methyl]pentan-1-amine (PubChem CID 107319957) has the molecular formula C11H16Cl2N2 and a molecular weight of 247.17 g/mol. Its IUPAC name is 5-chloro-N-[(3-chloro-4-pyridinyl)methyl]pentan-1-amine.
| Compound Name | 5-chloro-N-[(3-chloro-4-pyridinyl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 107319957 |
| Molecular Formula | C11H16Cl2N2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 5-chloro-N-[(3-chloro-4-pyridinyl)methyl]pentan-1-amine |
| SMILES | ClCCCCCNCc1ccncc1Cl |
| InChI | InChI=1S/C11H16Cl2N2/c12-5-2-1-3-6-14-8-10-4-7-15-9-11(10)13/h4,7,9,14H,1-3,5-6,8H2 |
| InChIKey | NRZDLNYRYUPSEU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|