C10H11ClN4O — CID 106400953
N-[(3-chloro-4-pyridinyl)methyl]-2-(1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 106400953) has the molecular formula C10H11ClN4O and a molecular weight of 238.68 g/mol. Its IUPAC name is N-[(3-chloro-4-pyridinyl)methyl]-2-(1,2,4-oxadiazol-3-yl)ethanamine.
| Compound Name | N-[(3-chloro-4-pyridinyl)methyl]-2-(1,2,4-oxadiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 106400953 |
| Molecular Formula | C10H11ClN4O |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | N-[(3-chloro-4-pyridinyl)methyl]-2-(1,2,4-oxadiazol-3-yl)ethanamine |
| SMILES | Clc1cnccc1CNCCc1ncon1 |
| InChI | InChI=1S/C10H11ClN4O/c11-9-6-13-3-1-8(9)5-12-4-2-10-14-7-16-15-10/h1,3,6-7,12H,2,4-5H2 |
| InChIKey | IDOQJAWWXMTTQT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|