C9H11N3O2 — CID 106396669
N-(furan-2-ylmethyl)-2-(1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 106396669) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(1,2,4-oxadiazol-3-yl)ethanamine.
| Compound Name | N-(furan-2-ylmethyl)-2-(1,2,4-oxadiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 106396669 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(1,2,4-oxadiazol-3-yl)ethanamine |
| SMILES | c1coc(CNCCc2ncon2)c1 |
| InChI | InChI=1S/C9H11N3O2/c1-2-8(13-5-1)6-10-4-3-9-11-7-14-12-9/h1-2,5,7,10H,3-4,6H2 |
| InChIKey | YCZNPWZZASDTEQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|