C15H22N2O2 — CID 170781680
N,N'-bis(furan-2-ylmethyl)pentane-1,5-diamine (PubChem CID 170781680) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N,N'-bis(furan-2-ylmethyl)pentane-1,5-diamine.
| Compound Name | N,N'-bis(furan-2-ylmethyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 170781680 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N,N'-bis(furan-2-ylmethyl)pentane-1,5-diamine |
| SMILES | c1coc(CNCCCCCNCc2ccco2)c1 |
| InChI | InChI=1S/C15H22N2O2/c1(2-8-16-12-14-6-4-10-18-14)3-9-17-13-15-7-5-11-19-15/h4-7,10-11,16-17H,1-3,8-9,12-13H2 |
| InChIKey | FPHFRPZSJXPKIQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|