C10H17NO2 — CID 79200814
5-(furan-2-ylmethylamino)pentan-2-ol (PubChem CID 79200814) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 5-(furan-2-ylmethylamino)pentan-2-ol.
| Compound Name | 5-(furan-2-ylmethylamino)pentan-2-ol |
|---|---|
| PubChem CID | 79200814 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 5-(furan-2-ylmethylamino)pentan-2-ol |
| SMILES | CC(O)CCCNCc1ccco1 |
| InChI | InChI=1S/C10H17NO2/c1-9(12)4-2-6-11-8-10-5-3-7-13-10/h3,5,7,9,11-12H,2,4,6,8H2,1H3 |
| InChIKey | QIQPICZRZXVJFJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|