C9H16N2O — CID 66594455
(3S)-1-N-(furan-2-ylmethyl)butane-1,3-diamine (PubChem CID 66594455) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is (3S)-1-N-(furan-2-ylmethyl)butane-1,3-diamine.
| Compound Name | (3S)-1-N-(furan-2-ylmethyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 66594455 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (3S)-1-N-(furan-2-ylmethyl)butane-1,3-diamine |
| SMILES | C[C@H](N)CCNCc1ccco1 |
| InChI | InChI=1S/C9H16N2O/c1-8(10)4-5-11-7-9-3-2-6-12-9/h2-3,6,8,11H,4-5,7,10H2,1H3/t8-/m0/s1 |
| InChIKey | YYRVXJRHRCOASH-QMMMGPOBSA-N |
| XLogP | 1.11 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|