C21H23NO — CID 40900150
(3R)-N-(furan-2-ylmethyl)-3,4-diphenylbutan-1-amine (PubChem CID 40900150) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is (3R)-N-(furan-2-ylmethyl)-3,4-diphenylbutan-1-amine.
| Compound Name | (3R)-N-(furan-2-ylmethyl)-3,4-diphenylbutan-1-amine |
|---|---|
| PubChem CID | 40900150 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (3R)-N-(furan-2-ylmethyl)-3,4-diphenylbutan-1-amine |
| SMILES | c1ccc(C[C@H](CCNCc2ccco2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23NO/c1-3-8-18(9-4-1)16-20(19-10-5-2-6-11-19)13-14-22-17-21-12-7-15-23-21/h1-12,15,20,22H,13-14,16-17H2/t20-/m0/s1 |
| InChIKey | PJSOPOCDCSDNCY-FQEVSTJZSA-N |
| XLogP | 4.79 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|