C16H22N2O — CID 54809598
N-(furan-2-ylmethyl)-N'-(1-phenylpropyl)ethane-1,2-diamine (PubChem CID 54809598) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-(1-phenylpropyl)ethane-1,2-diamine.
| Compound Name | N-(furan-2-ylmethyl)-N'-(1-phenylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54809598 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-(1-phenylpropyl)ethane-1,2-diamine |
| SMILES | CCC(NCCNCc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C16H22N2O/c1-2-16(14-7-4-3-5-8-14)18-11-10-17-13-15-9-6-12-19-15/h3-9,12,16-18H,2,10-11,13H2,1H3 |
| InChIKey | BDQCSAWBIGMIEB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|