C18H17NO — CID 15830516
N-(furan-2-ylmethyl)-1,1-diphenylmethanamine (PubChem CID 15830516) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1,1-diphenylmethanamine.
| Compound Name | N-(furan-2-ylmethyl)-1,1-diphenylmethanamine |
|---|---|
| PubChem CID | 15830516 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-1,1-diphenylmethanamine |
| SMILES | c1ccc(C(NCc2ccco2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17NO/c1-3-8-15(9-4-1)18(16-10-5-2-6-11-16)19-14-17-12-7-13-20-17/h1-13,18-19H,14H2 |
| InChIKey | JGZKBTISZPLJPS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |