C19H19NO — CID 103603203
N-(furan-2-ylmethyl)-2,2-diphenylethanamine (PubChem CID 103603203) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2,2-diphenylethanamine.
| Compound Name | N-(furan-2-ylmethyl)-2,2-diphenylethanamine |
|---|---|
| PubChem CID | 103603203 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-2,2-diphenylethanamine |
| SMILES | c1ccc(C(CNCc2ccco2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19NO/c1-3-8-16(9-4-1)19(17-10-5-2-6-11-17)15-20-14-18-12-7-13-21-18/h1-13,19-20H,14-15H2 |
| InChIKey | QMMJGXSXFNNPAF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |