C21H23NO2 — CID 3063265
3-(furan-2-ylmethylamino)-2-methyl-1,1-diphenylpropan-1-ol (PubChem CID 3063265) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-(furan-2-ylmethylamino)-2-methyl-1,1-diphenylpropan-1-ol.
| Compound Name | 3-(furan-2-ylmethylamino)-2-methyl-1,1-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 3063265 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 3-(furan-2-ylmethylamino)-2-methyl-1,1-diphenylpropan-1-ol |
| SMILES | CC(CNCc1ccco1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO2/c1-17(15-22-16-20-13-8-14-24-20)21(23,18-9-4-2-5-10-18)19-11-6-3-7-12-19/h2-14,17,22-23H,15-16H2,1H3 |
| InChIKey | ZQYDMNMPHKWKJM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |