C8H12NO3S- — CID 174965777
3-(furan-2-ylmethylamino)propane-1-sulfinate (PubChem CID 174965777) has the molecular formula C8H12NO3S- and a molecular weight of 202.25 g/mol. Its IUPAC name is 3-(furan-2-ylmethylamino)propane-1-sulfinate.
| Compound Name | 3-(furan-2-ylmethylamino)propane-1-sulfinate |
|---|---|
| PubChem CID | 174965777 |
| Molecular Formula | C8H12NO3S- |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 3-(furan-2-ylmethylamino)propane-1-sulfinate |
| SMILES | O=S([O-])CCCNCc1ccco1 |
| InChI | InChI=1S/C8H13NO3S/c10-13(11)6-2-4-9-7-8-3-1-5-12-8/h1,3,5,9H,2,4,6-7H2,(H,10,11)/p-1 |
| InChIKey | CZVZUZURARPHGL-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 65.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|