C19H27NO3 — CID 2364400
6-(2-ethoxyphenoxy)-N-(furan-2-ylmethyl)hexan-1-amine (PubChem CID 2364400) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 6-(2-ethoxyphenoxy)-N-(furan-2-ylmethyl)hexan-1-amine.
| Compound Name | 6-(2-ethoxyphenoxy)-N-(furan-2-ylmethyl)hexan-1-amine |
|---|---|
| PubChem CID | 2364400 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 6-(2-ethoxyphenoxy)-N-(furan-2-ylmethyl)hexan-1-amine |
| SMILES | CCOc1ccccc1OCCCCCCNCc1ccco1 |
| InChI | InChI=1S/C19H27NO3/c1-2-21-18-11-5-6-12-19(18)23-14-8-4-3-7-13-20-16-17-10-9-15-22-17/h5-6,9-12,15,20H,2-4,7-8,13-14,16H2,1H3 |
| InChIKey | DPEGLGFTKYKHPU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|