C15H20N2O2 — CID 54809908
N'-(2-ethoxyphenyl)-N-(furan-2-ylmethyl)ethane-1,2-diamine (PubChem CID 54809908) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N'-(2-ethoxyphenyl)-N-(furan-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-(2-ethoxyphenyl)-N-(furan-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54809908 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N'-(2-ethoxyphenyl)-N-(furan-2-ylmethyl)ethane-1,2-diamine |
| SMILES | CCOc1ccccc1NCCNCc1ccco1 |
| InChI | InChI=1S/C15H20N2O2/c1-2-18-15-8-4-3-7-14(15)17-10-9-16-12-13-6-5-11-19-13/h3-8,11,16-17H,2,9-10,12H2,1H3 |
| InChIKey | SUVIHSFGIFOPLK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|