C17H18N4O2 — CID 112858656
4-N-(2-ethoxyphenyl)-6-N-(furan-2-ylmethyl)pyrimidine-4,6-diamine (PubChem CID 112858656) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 4-N-(2-ethoxyphenyl)-6-N-(furan-2-ylmethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-ethoxyphenyl)-6-N-(furan-2-ylmethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112858656 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-N-(2-ethoxyphenyl)-6-N-(furan-2-ylmethyl)pyrimidine-4,6-diamine |
| SMILES | CCOc1ccccc1Nc1cc(NCc2ccco2)ncn1 |
| InChI | InChI=1S/C17H18N4O2/c1-2-22-15-8-4-3-7-14(15)21-17-10-16(19-12-20-17)18-11-13-6-5-9-23-13/h3-10,12H,2,11H2,1H3,(H2,18,19,20,21) |
| InChIKey | HNMDYKFAQHPBEZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |