C18H15N5O — CID 112858694
6-N-(furan-2-ylmethyl)-4-N-quinolin-8-ylpyrimidine-4,6-diamine (PubChem CID 112858694) has the molecular formula C18H15N5O and a molecular weight of 317.35 g/mol. Its IUPAC name is 6-N-(furan-2-ylmethyl)-4-N-quinolin-8-ylpyrimidine-4,6-diamine.
| Compound Name | 6-N-(furan-2-ylmethyl)-4-N-quinolin-8-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112858694 |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 6-N-(furan-2-ylmethyl)-4-N-quinolin-8-ylpyrimidine-4,6-diamine |
| SMILES | c1coc(CNc2cc(Nc3cccc4cccnc34)ncn2)c1 |
| InChI | InChI=1S/C18H15N5O/c1-4-13-5-2-8-19-18(13)15(7-1)23-17-10-16(21-12-22-17)20-11-14-6-3-9-24-14/h1-10,12H,11H2,(H2,20,21,22,23) |
| InChIKey | VEFLXSIHYQYIHN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |