C22H21N5O2 — CID 112862636
6-N-[(3,4-dimethoxyphenyl)methyl]-4-N-quinolin-8-ylpyrimidine-4,6-diamine (PubChem CID 112862636) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 6-N-[(3,4-dimethoxyphenyl)methyl]-4-N-quinolin-8-ylpyrimidine-4,6-diamine.
| Compound Name | 6-N-[(3,4-dimethoxyphenyl)methyl]-4-N-quinolin-8-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112862636 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 6-N-[(3,4-dimethoxyphenyl)methyl]-4-N-quinolin-8-ylpyrimidine-4,6-diamine |
| SMILES | COc1ccc(CNc2cc(Nc3cccc4cccnc34)ncn2)cc1OC |
| InChI | InChI=1S/C22H21N5O2/c1-28-18-9-8-15(11-19(18)29-2)13-24-20-12-21(26-14-25-20)27-17-7-3-5-16-6-4-10-23-22(16)17/h3-12,14H,13H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | MYLDKBXIXSTFSJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |