C9H15N3O2 — CID 77029971
4-(furan-2-ylmethylamino)-N'-hydroxybutanimidamide (PubChem CID 77029971) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-(furan-2-ylmethylamino)-N'-hydroxybutanimidamide.
| Compound Name | 4-(furan-2-ylmethylamino)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 77029971 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-(furan-2-ylmethylamino)-N'-hydroxybutanimidamide |
| SMILES | NC(CCCNCc1ccco1)=NO |
| InChI | InChI=1S/C9H15N3O2/c10-9(12-13)4-1-5-11-7-8-3-2-6-14-8/h2-3,6,11,13H,1,4-5,7H2,(H2,10,12) |
| InChIKey | MWMYMHBSSOSFQU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|