C12H14FN3O — CID 114183458
N-[(5-fluoro-2-methylphenyl)methyl]-2-(1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 114183458) has the molecular formula C12H14FN3O and a molecular weight of 235.26 g/mol. Its IUPAC name is N-[(5-fluoro-2-methylphenyl)methyl]-2-(1,2,4-oxadiazol-3-yl)ethanamine.
| Compound Name | N-[(5-fluoro-2-methylphenyl)methyl]-2-(1,2,4-oxadiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 114183458 |
| Molecular Formula | C12H14FN3O |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | N-[(5-fluoro-2-methylphenyl)methyl]-2-(1,2,4-oxadiazol-3-yl)ethanamine |
| SMILES | Cc1ccc(F)cc1CNCCc1ncon1 |
| InChI | InChI=1S/C12H14FN3O/c1-9-2-3-11(13)6-10(9)7-14-5-4-12-15-8-17-16-12/h2-3,6,8,14H,4-5,7H2,1H3 |
| InChIKey | XAEABADTOIYOIP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|