C11H13N3O — CID 106396500
N-benzyl-2-(1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 106396500) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is N-benzyl-2-(1,2,4-oxadiazol-3-yl)ethanamine.
| Compound Name | N-benzyl-2-(1,2,4-oxadiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 106396500 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-benzyl-2-(1,2,4-oxadiazol-3-yl)ethanamine |
| SMILES | c1ccc(CNCCc2ncon2)cc1 |
| InChI | InChI=1S/C11H13N3O/c1-2-4-10(5-3-1)8-12-7-6-11-13-9-15-14-11/h1-5,9,12H,6-8H2 |
| InChIKey | YFOKGYHUAKTAPE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|