C13H17N3O2 — CID 114184065
N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-3-phenoxypropan-1-amine (PubChem CID 114184065) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-3-phenoxypropan-1-amine.
| Compound Name | N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-3-phenoxypropan-1-amine |
|---|---|
| PubChem CID | 114184065 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-3-phenoxypropan-1-amine |
| SMILES | c1ccc(OCCCNCCc2ncon2)cc1 |
| InChI | InChI=1S/C13H17N3O2/c1-2-5-12(6-3-1)17-10-4-8-14-9-7-13-15-11-18-16-13/h1-3,5-6,11,14H,4,7-10H2 |
| InChIKey | LUDFYKPOOBLSEC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|