C14H23ClN2 — CID 102905612
N-[(3-chloro-4-pyridinyl)methyl]-3-methyl-2-propan-2-ylbutan-1-amine (PubChem CID 102905612) has the molecular formula C14H23ClN2 and a molecular weight of 254.80 g/mol. Its IUPAC name is N-[(3-chloro-4-pyridinyl)methyl]-3-methyl-2-propan-2-ylbutan-1-amine.
| Compound Name | N-[(3-chloro-4-pyridinyl)methyl]-3-methyl-2-propan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 102905612 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-[(3-chloro-4-pyridinyl)methyl]-3-methyl-2-propan-2-ylbutan-1-amine |
| SMILES | CC(C)C(CNCc1ccncc1Cl)C(C)C |
| InChI | InChI=1S/C14H23ClN2/c1-10(2)13(11(3)4)8-17-7-12-5-6-16-9-14(12)15/h5-6,9-11,13,17H,7-8H2,1-4H3 |
| InChIKey | DIGWPCKBMRFCHK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |