C14H14BrClN2 — CID 81359257
(1S)-1-(4-bromophenyl)-N-[(3-chloro-4-pyridinyl)methyl]ethanamine (PubChem CID 81359257) has the molecular formula C14H14BrClN2 and a molecular weight of 325.64 g/mol. Its IUPAC name is (1S)-1-(4-bromophenyl)-N-[(3-chloro-4-pyridinyl)methyl]ethanamine.
| Compound Name | (1S)-1-(4-bromophenyl)-N-[(3-chloro-4-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 81359257 |
| Molecular Formula | C14H14BrClN2 |
| Molecular Weight | 325.64 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | (1S)-1-(4-bromophenyl)-N-[(3-chloro-4-pyridinyl)methyl]ethanamine |
| SMILES | C[C@H](NCc1ccncc1Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H14BrClN2/c1-10(11-2-4-13(15)5-3-11)18-8-12-6-7-17-9-14(12)16/h2-7,9-10,18H,8H2,1H3/t10-/m0/s1 |
| InChIKey | KQRMYQAMTYNJSA-JTQLQIEISA-N |
| XLogP | 4.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.64 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |