C15H14BrCl2NO — CID 81359211
2-[[[(1S)-1-(4-bromophenyl)ethyl]amino]methyl]-4,6-dichlorophenol (PubChem CID 81359211) has the molecular formula C15H14BrCl2NO and a molecular weight of 375.09 g/mol. Its IUPAC name is 2-[[[(1S)-1-(4-bromophenyl)ethyl]amino]methyl]-4,6-dichlorophenol.
| Compound Name | 2-[[[(1S)-1-(4-bromophenyl)ethyl]amino]methyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 81359211 |
| Molecular Formula | C15H14BrCl2NO |
| Molecular Weight | 375.09 g/mol |
| Exact Mass | 372.96 |
| IUPAC Name | 2-[[[(1S)-1-(4-bromophenyl)ethyl]amino]methyl]-4,6-dichlorophenol |
| SMILES | C[C@H](NCc1cc(Cl)cc(Cl)c1O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H14BrCl2NO/c1-9(10-2-4-12(16)5-3-10)19-8-11-6-13(17)7-14(18)15(11)20/h2-7,9,19-20H,8H2,1H3/t9-/m0/s1 |
| InChIKey | VQNHKZUEIHYGDP-VIFPVBQESA-N |
| XLogP | 5.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.09 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|