C12H13Cl2N3O — CID 103854969
2,4-dichloro-6-[[1-(1H-pyrazol-4-yl)ethylamino]methyl]phenol (PubChem CID 103854969) has the molecular formula C12H13Cl2N3O and a molecular weight of 286.16 g/mol. Its IUPAC name is 2,4-dichloro-6-[[1-(1H-pyrazol-4-yl)ethylamino]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[1-(1H-pyrazol-4-yl)ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 103854969 |
| Molecular Formula | C12H13Cl2N3O |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2,4-dichloro-6-[[1-(1H-pyrazol-4-yl)ethylamino]methyl]phenol |
| SMILES | CC(NCc1cc(Cl)cc(Cl)c1O)c1cn[nH]c1 |
| InChI | InChI=1S/C12H13Cl2N3O/c1-7(9-5-16-17-6-9)15-4-8-2-10(13)3-11(14)12(8)18/h2-3,5-7,15,18H,4H2,1H3,(H,16,17) |
| InChIKey | RPAFTLXQOUYHIM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|