C13H15N3O3 — CID 103855082
6-[[1-(1H-pyrazol-4-yl)ethylamino]methyl]-1,3-benzodioxol-5-ol (PubChem CID 103855082) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 6-[[1-(1H-pyrazol-4-yl)ethylamino]methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[[1-(1H-pyrazol-4-yl)ethylamino]methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 103855082 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 6-[[1-(1H-pyrazol-4-yl)ethylamino]methyl]-1,3-benzodioxol-5-ol |
| SMILES | CC(NCc1cc2c(cc1O)OCO2)c1cn[nH]c1 |
| InChI | InChI=1S/C13H15N3O3/c1-8(10-5-15-16-6-10)14-4-9-2-12-13(3-11(9)17)19-7-18-12/h2-3,5-6,8,14,17H,4,7H2,1H3,(H,15,16) |
| InChIKey | ZBGJRXPFDLOVNX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|