C16H16ClNO3 — CID 81363015
6-[[[(1S)-1-(3-chlorophenyl)ethyl]amino]methyl]-1,3-benzodioxol-5-ol (PubChem CID 81363015) has the molecular formula C16H16ClNO3 and a molecular weight of 305.76 g/mol. Its IUPAC name is 6-[[[(1S)-1-(3-chlorophenyl)ethyl]amino]methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[[[(1S)-1-(3-chlorophenyl)ethyl]amino]methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 81363015 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 6-[[[(1S)-1-(3-chlorophenyl)ethyl]amino]methyl]-1,3-benzodioxol-5-ol |
| SMILES | C[C@H](NCc1cc2c(cc1O)OCO2)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H16ClNO3/c1-10(11-3-2-4-13(17)5-11)18-8-12-6-15-16(7-14(12)19)21-9-20-15/h2-7,10,18-19H,8-9H2,1H3/t10-/m0/s1 |
| InChIKey | RGXUFMZSOPGZKK-JTQLQIEISA-N |
| XLogP | 3.63 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|