C11H13Cl2NO — CID 115691167
2-[(but-3-en-2-ylamino)methyl]-4,6-dichlorophenol (PubChem CID 115691167) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is 2-[(but-3-en-2-ylamino)methyl]-4,6-dichlorophenol.
| Compound Name | 2-[(but-3-en-2-ylamino)methyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 115691167 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-[(but-3-en-2-ylamino)methyl]-4,6-dichlorophenol |
| SMILES | C=CC(C)NCc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C11H13Cl2NO/c1-3-7(2)14-6-8-4-9(12)5-10(13)11(8)15/h3-5,7,14-15H,1,6H2,2H3 |
| InChIKey | PLBAGMPZUMXZOQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|