C11H13Cl2NO3 — CID 60780743
methyl 2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]propanoate (PubChem CID 60780743) has the molecular formula C11H13Cl2NO3 and a molecular weight of 278.13 g/mol. Its IUPAC name is methyl 2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]propanoate.
| Compound Name | methyl 2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]propanoate |
|---|---|
| PubChem CID | 60780743 |
| Molecular Formula | C11H13Cl2NO3 |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | methyl 2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]propanoate |
| SMILES | COC(=O)C(C)NCc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C11H13Cl2NO3/c1-6(11(16)17-2)14-5-7-3-8(12)4-9(13)10(7)15/h3-4,6,14-15H,5H2,1-2H3 |
| InChIKey | PYOFLXGKOHBRRG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|